|
|
| | 2-(Trifluoromethyl)furan-3-carboxylic acid Basic information |
| | 2-(Trifluoromethyl)furan-3-carboxylic acid Chemical Properties |
| storage temp. | Sealed in dry,Room Temperature | | form | solid | | InChI | 1S/C6H3F3O3/c7-6(8,9)4-3(5(10)11)1-2-12-4/h1-2H,(H,10,11) | | InChIKey | HYIKIZXFYAKIPK-UHFFFAOYSA-N | | SMILES | OC(C1=C(OC=C1)C(F)(F)F)=O |
| HS Code | 2932190090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 2-(Trifluoromethyl)furan-3-carboxylic acid Usage And Synthesis |
| | 2-(Trifluoromethyl)furan-3-carboxylic acid Preparation Products And Raw materials |
|