Clindamycin (2R-cis)-Diastereomer 2-Phosphate manufacturers
|
| | Clindamycin (2R-cis)-Diastereomer 2-Phosphate Basic information |
| Product Name: | Clindamycin (2R-cis)-Diastereomer 2-Phosphate | | Synonyms: | Clindamycin (2R-cis)-Diastereomer 2-Phosphate;Clindamycin Impurity 27;Clindamycin Diastereomer 2-Phosphate/Methyl 7-chloro-6,7,8-trideoxy-6-[[[(2R,4R)-1-methyl-4-propyl-2-pyrrolidinyl]carbonyl]amino]-1-thio-, 2-(dihydrogen phosphate) L-threo-α-D-galacto-octopyranoside;Clindamycin Diastereomer 2-Phosphate;Clindamycin Phosphate Impurity 12;L-threo-α-D-galacto-Octopyranoside, methyl 7-chloro-6,7,8-trideoxy-6-[[[(2R,4R)-1-methyl-4-propyl-2-pyrrolidinyl]carbonyl]amino]-1-thio-, 2-(dihydrogen phosphate);Clindamycin Phosphate α-Isomer;Clindamycin Impurity 42 | | CAS: | 1800297-62-4 | | MF: | C18H34ClN2O8PS | | MW: | 504.96 | | EINECS: | | | Product Categories: | | | Mol File: | 1800297-62-4.mol |  |
| | Clindamycin (2R-cis)-Diastereomer 2-Phosphate Chemical Properties |
| density | 1.41±0.1 g/cm3(Predicted) | | pka | 1.83±0.10(Predicted) | | InChIKey | UFUVLHLTWXBHGZ-XXZWWVCJNA-N | | SMILES | [C@]([H])([C@]1([H])[C@@H]([C@H](O)[C@@H](OP(O)(O)=O)[C@@H](SC)O1)O)([C@@H](Cl)C)NC([C@@H]1N(C[C@H](CCC)C1)C)=O |&1:0,2,4,5,7,13,18,23,26,r| |
| | Clindamycin (2R-cis)-Diastereomer 2-Phosphate Usage And Synthesis |
| Uses | Clindamycin Diastereomer 2-Phosphate is an impurity of Clindamycin (C580115), a semi-synthetic antibiotic. Antibacterial. |
| | Clindamycin (2R-cis)-Diastereomer 2-Phosphate Preparation Products And Raw materials |
|