1,3-bis(4-bromophenyl)propane-1,3-dione manufacturers
|
| | 1,3-bis(4-bromophenyl)propane-1,3-dione Basic information |
| Product Name: | 1,3-bis(4-bromophenyl)propane-1,3-dione | | Synonyms: | 1,3-bis(4-bromophenyl)propane-1,3-dione;1,3-Propanedione, 1,3-bis(4-bromophenyl)-;1,3-Bis(4-bromophenyl)-1,3-propanedione;1,3-Bis(4-bromophenyl)propane-1,3-dione - [B94361] | | CAS: | 33170-68-2 | | MF: | C15H10Br2O2 | | MW: | 382.05 | | EINECS: | | | Product Categories: | | | Mol File: | 33170-68-2.mol |  |
| | 1,3-bis(4-bromophenyl)propane-1,3-dione Chemical Properties |
| Melting point | 184 °C | | Boiling point | 488.3±40.0 °C(Predicted) | | density | 1.666±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 8.37±0.13(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C15H10Br2O2/c16-12-5-1-10(2-6-12)14(18)9-15(19)11-3-7-13(17)8-4-11/h1-8H,9H2 | | InChIKey | HOVMFCOUXZBNBX-UHFFFAOYSA-N | | SMILES | C(C1=CC=C(Br)C=C1)(=O)CC(C1=CC=C(Br)C=C1)=O |
| | 1,3-bis(4-bromophenyl)propane-1,3-dione Usage And Synthesis |
| | 1,3-bis(4-bromophenyl)propane-1,3-dione Preparation Products And Raw materials |
|