| Company Name: |
TCI Europe |
| Tel: |
320-37350700 |
| Email: |
sales@tcieurope.eu |
|
| | anthracene-2,6-diol Basic information |
| | anthracene-2,6-diol Chemical Properties |
| Melting point | 300°C(lit.) | | Boiling point | 475.0±18.0 °C(Predicted) | | density | 1.360±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, stored under nitrogen | | form | powder to crystal | | pka | 9.39±0.30(Predicted) | | color | Light yellow to Brown | | InChI | InChI=1S/C14H10O2/c15-13-3-1-9-5-12-8-14(16)4-2-10(12)6-11(9)7-13/h1-8,15-16H | | InChIKey | JBBHFHMVEOHFRE-UHFFFAOYSA-N | | SMILES | C1=C2C(C=C3C(=C2)C=CC(O)=C3)=CC=C1O |
| | anthracene-2,6-diol Usage And Synthesis |
| | anthracene-2,6-diol Preparation Products And Raw materials |
|