| Company Name: |
Cool Pharm, Ltd |
| Tel: |
021-58581007 18019463053 |
| Email: |
sales@coolpharm.com |
|
| | Heptamethine cyanine dye-1 Basic information |
| Product Name: | Heptamethine cyanine dye-1 | | Synonyms: | Heptamethine cyanine dye-1;1H-Benz[e]indolium,2-[2-[2-chloro-3-[2-(3-ethyl- 1,3-dihydro-1,1-dimethyl-2H-benz[e]indol-2- ylidene)ethylidene]-1-cyclohexen-1-yl]ethenyl]- 3-ethyl-1,1-dimethyl-, iodide, 97%;ADS 815EI;ADS 815EI, >96%;Heptamethine cyanine dye-1, >96%;1H benzo [e] indolinium;Heptamethine cyanine dye-1(Synonyms: ADS 815EI);2-((E)-2-((E)-2-chloro-3-((E)-2-(3-ethyl-1,1-dimethyl-1,3-dihydro-2H-benzo[e]indol-2-ylidene)ethylidene)cyclohex-1-en-1-yl)vinyl)-3-ethyl-1,1-dimethyl-1H-benzo[e]indol-3-ium iodide | | CAS: | 162411-29-2 | | MF: | C42H44ClN2.I | | MW: | 739.17 | | EINECS: | | | Product Categories: | | | Mol File: | 162411-29-2.mol |  |
| | Heptamethine cyanine dye-1 Chemical Properties |
| form | Solid | | color | Light brown to black | | InChIKey | CNQCCCLLXKARPK-UHFFFAOYSA-M | | SMILES | CC1(C(=[N+](C2C=CC3=CC=CC=C3C=21)CC)C=CC1CCCC(C=1Cl)=CC=C1C(C2C3=CC=CC=C3C=CC=2N1CC)(C)C)C.[I-] |
| | Heptamethine cyanine dye-1 Usage And Synthesis |
| Uses | Heptamethine cyanine dye-1 is a near-infrared cyanine dye for fluorescence imaging in biological systems. |
| | Heptamethine cyanine dye-1 Preparation Products And Raw materials |
|