| Company Name: |
Wuxi AppTec
|
| Tel: |
022-59987777 13552403979 |
| Email: |
jia_guoqiang@wuxiapptec.com |
| Products Intro: |
Product Name:2-(3-methoxybenzyl)succinic acid
CAS:20940-75-4
Purity:95%+ Package:1G,5G,10G,25G,50G,100G,250G Remarks:in stock
|
| Company Name: |
Aikon International Limited
|
| Tel: |
025-58859352 18068836627 |
| Email: |
sales01@aikonchem.com |
| Products Intro: |
Product Name:2-(3-methoxybenzyl)succinic acid
CAS:20940-75-4
Purity:95+% Package:1g;5g;10g
|
| Company Name: |
Beijing Stronger Science Co., Ltd.
|
| Tel: |
0531-88924771 15614660963 |
| Email: |
elsa.hang@strongerscience.com |
| Products Intro: |
CAS:20940-75-4
Purity:0.95 Package:1g;100mg;250mg
|
|
| | 2-(3-methoxybenzyl)succinic acid Basic information |
| | 2-(3-methoxybenzyl)succinic acid Chemical Properties |
| solubility | DMSO: 2 mg/mL, clear | | form | powder | | color | white to beige | | SMILES | OC(CC(CC1=CC=CC(OC)=C1)C(O)=O)=O |
| | 2-(3-methoxybenzyl)succinic acid Usage And Synthesis |
| Uses | SLC13A3i may be used in studies for its role in inhibiting the uptake of itaconate in tumor cells, which may help understand tumor immune evasion mechanisms and improve cancer treatment strategies. It may also be used to explore metabolic pathways related to integrin functions and their impact on cellular processes, particularly in cancer research. |
| | 2-(3-methoxybenzyl)succinic acid Preparation Products And Raw materials |
|