- Boc-L-Proline-methyl ester
-
- $0.00 / 1KG
-
2026-02-27
- CAS:59936-29-7
- Min. Order: 1KG
- Purity: Not less than 98%
- Supply Ability: 5MT per month
|
| | Boc-L-Proline-methyl ester Basic information |
| | Boc-L-Proline-methyl ester Chemical Properties |
| Boiling point | 135°C/16mmHg(lit.) | | density | 1.120±0.06 g/cm3(Predicted) | | refractive index | 1.4510 to 1.4550 | | storage temp. | 2-8°C | | form | clear liquid | | pka | -3.35±0.40(Predicted) | | color | Colorless to Light yellow | | Water Solubility | Slightly soluble in water. | | InChI | InChI=1S/C11H19NO4/c1-11(2,3)16-10(14)12-7-5-6-8(12)9(13)15-4/h8H,5-7H2,1-4H3/t8-/m0/s1 | | InChIKey | WVDGSSCWFMSRHN-QMMMGPOBSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CCC[C@H]1C(OC)=O | | CAS DataBase Reference | 59936-29-7(CAS DataBase Reference) |
| | Boc-L-Proline-methyl ester Usage And Synthesis |
| Chemical Properties | Colorless or slightly yellow liquid | | Uses | N-Boc-L-proline methyl ester is generally used as a intermediate in pharmaceutical and chemical research. |
| | Boc-L-Proline-methyl ester Preparation Products And Raw materials |
|