|
|
| | Urea,N-phenyl-N'-(phenylmethyl)- Basic information |
| | Urea,N-phenyl-N'-(phenylmethyl)- Chemical Properties |
| Melting point | 169-171 °C | | Boiling point | 366.5±25.0 °C(Predicted) | | density | 1.178±0.06 g/cm3(Predicted) | | pka | 12+-.0.46(Predicted) | | InChI | InChI=1S/C14H14N2O/c17-14(16-13-9-5-2-6-10-13)15-11-12-7-3-1-4-8-12/h1-10H,11H2,(H2,15,16,17) | | InChIKey | XXFBRXQVPJVXFB-UHFFFAOYSA-N | | SMILES | N(C1=CC=CC=C1)C(NCC1=CC=CC=C1)=O |
| RIDADR | UN3077 | | HazardClass | 9 |
| | Urea,N-phenyl-N'-(phenylmethyl)- Usage And Synthesis |
| Synthesis Reference(s) | The Journal of Organic Chemistry, 27, p. 1902, 1962 DOI: 10.1021/jo01052a517 |
| | Urea,N-phenyl-N'-(phenylmethyl)- Preparation Products And Raw materials |
|