- 1,4-Diethynylbenzene
-
- $0.00 / 25KG
-
2025-06-27
- CAS:935-14-8
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 500000kg
- 1,4-Diethynylbenzene
-
- $50.00 / 1kg
-
2025-06-20
- CAS:935-14-8
- Min. Order: 1kg
- Purity: 0.99
- Supply Ability: 20 tons
- 1,4-Diethynylbenzene
-
- $1.00 / 1KG
-
2020-01-03
- CAS:935-14-8
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 200kg
|
| | 1,4-Diethynylbenzene Basic information |
| Product Name: | 1,4-Diethynylbenzene | | Synonyms: | 1,4-Bis(ethynyl)benzene;1,4-diethynyl-benzen;Benzene,1,4-diethynyl-;p-diethynyl-benzen;1,4-Diethylnylbenzene, 97%;p-DIETHYNYLBENZENE, 98%p-DIETHYNYLBENZENE, 98%p-DIETHYNYLBENZENE, 98%p-DIETHYNYLBENZENE, 98%;P-DIETHYNYLBENZENE;Benzene, 1,4-diethynyl- (9CI) | | CAS: | 935-14-8 | | MF: | C10H6 | | MW: | 126.15 | | EINECS: | | | Product Categories: | Building Blocks;Chemical Synthesis;Organic Building Blocks;Acetylenes;Acetylenic Hydrocarbons having Benzene Ring;Building Blocks for Liquid Crystals;Chalcones, etc. (Building Blocks for Liquid Crystals);Fluorenes, etc. (reagent for high-performance polymer research);Functional Materials;Reagent for High-Performance Polymer Research;Alkynes;Organic Building Blocks;Terminal;Miscellaneous Natural Products | | Mol File: | 935-14-8.mol |  |
| | 1,4-Diethynylbenzene Chemical Properties |
| Melting point | 94-98 °C(lit.) | | Boiling point | 182.8±23.0 °C(Predicted) | | density | 1.00±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | almost transparency in Methanol | | form | Crystalline Powder | | color | White or orange-brown | | InChI | InChI=1S/C10H6/c1-3-9-5-7-10(4-2)8-6-9/h1-2,5-8H | | InChIKey | MVLGANVFCMOJHR-UHFFFAOYSA-N | | SMILES | C1(C#C)=CC=C(C#C)C=C1 | | CAS DataBase Reference | 935-14-8(CAS DataBase Reference) | | NIST Chemistry Reference | 1,4-Diethynylbenzene(935-14-8) |
| Hazard Codes | Xi,F | | Risk Statements | 43-52/53-36/37 | | Safety Statements | 37/39-26 | | RIDADR | 1325 | | WGK Germany | 3 | | RTECS | CZ5643000 | | Hazard Note | Irritant/Highly Flammable | | HazardClass | 4.1 | | HS Code | 29029090 |
| | 1,4-Diethynylbenzene Usage And Synthesis |
| Chemical Properties | White or orange-brown crystalline powder |
| | 1,4-Diethynylbenzene Preparation Products And Raw materials |
|