|
|
| | Cytidine-5'-diphosphate disodium salt Basic information |
| Product Name: | Cytidine-5'-diphosphate disodium salt | | Synonyms: | -diphosphate disodium salt;Disodium cytidine 5'-diphosphate;-diphospho-dimethylaminoethanol Sodium Salt;Cytidine 5′-diphosphate disodium salt hydrate;-Dicyclohexyl-4-morpholinecarboximidamide;CYTIDINE-5'-DIPHOSPHATE DISODIUM SALT HEMIHYDRATE;cytidine-5'-diphosphatedisodiumsalthemihydratecrystalline;Cytidine-5'-diphosphate disodium salt | | CAS: | 54394-90-0 | | MF: | C9H16N3NaO11P2 | | MW: | 427.17 | | EINECS: | 2017-001-1 | | Product Categories: | Material;Pharmaceutical | | Mol File: | 54394-90-0.mol |  |
| | Cytidine-5'-diphosphate disodium salt Chemical Properties |
| form | Powder | | color | White to Off-white | | InChIKey | MAGSIBHRUIBONY-RFFBCSJBNA-N | | SMILES | O[C@@H]1[C@@H]([C@@H](COP(O)(=O)OP(O)(O)=O)O[C@H]1N1C=CC(N)=NC1=O)O.[NaH] |&1:1,2,3,15,r| |
| | Cytidine-5'-diphosphate disodium salt Usage And Synthesis |
| Uses | Cytidine-5'-diphosphate disodium salt is a nucleoside diphosphate that acts as a carrier for phosphorylcholine, diacylglycerol, and other molecules during phospholipid synthesis.
| | Biosynthesis |
Cytidine-5'-diphosphate disodium salt is a nucleotide that is synthesized in the cytosol.
| | Biochem/physiol Actions |
Cytidine 5'-diphosphate disodium salt (CDP-Na2) prevents the action of aspartate carbamoyltransferase. This enzyme participates in pyrimidine biosynthesis. Like adenosine triphosphate (ATP), CTP serves as a molecule of high energy. It acts as a coenzyme in glycerophospholipid biosynthesis and protein glycosylation.
|
| | Cytidine-5'-diphosphate disodium salt Preparation Products And Raw materials |
|