Cobalt tetramethoxyphenylporphyrin manufacturers
|
| | Cobalt tetramethoxyphenylporphyrin Basic information |
| Product Name: | Cobalt tetramethoxyphenylporphyrin | | Synonyms: | TMOPP-Co, 5,10,15,20-Tetrakis(4-methoxyphenyl)porphyrine cobalt(II) Complex;Cobalt tetramethoxyphenylporphyrin,94%;5,10,15,20-TETRAKIS(4-METHOXYPHENYL)-21H,23H-PORPHYRINE COBALT(II);[5,10,15,20-TETRAKIS(4-METHOXYPHENYL)-21H,23H-PORPHINATO]COBALT(II);5,10,15,20-TETRAKIS(4-METHOXYPHENYL)-21H,23H-PORPHINE COBALT(II);5,10,15,20-TETRAKIS(4-METHOXYPHENYL)-21H ,23H-PORPHINE COBALT(II), SYNTHETIC;Cobalt(II) meso-tetrakis(4-methoxyphenyl)porphine;Co(II) meso-Tetra (4-methoxyphenyl) Porphine (1-3% chlorin) | | CAS: | 28903-71-1 | | MF: | C48H36CoN4O4 | | MW: | 791.77 | | EINECS: | 677-580-2 | | Product Categories: | metal porphine (porphyrin) complex;Transition Metal Compounds;CobaltPhotonic and Optical Materials;Catalysis and Inorganic Chemistry;Chemical Synthesis;Phthalocyanine and Porphyrin Dyes;Porphyrines;Biochemistry;Classes of Metal Compounds;Co (Cobalt) Compounds;Porphyrins | | Mol File: | 28903-71-1.mol |  |
| | Cobalt tetramethoxyphenylporphyrin Chemical Properties |
| Melting point | 241-248°C | | storage temp. | Sealed in dry,Room Temperature | | form | Crystals or Powder | | color | Purple to violet | | Appearance | Purple to blue-purple crystals or powder | | λmax | 417 nm
530 nm (2nd) | | InChIKey | QBCIMRXPMLWVML-NHZJRHMYSA-N | | SMILES | O(C1C=CC(C2=C3C=CC4C(C5C=CC(OC)=CC=5)=C5C=CC6=C(C7C=CC(OC)=CC=7)C7C=CC8=C(C9C=CC(OC)=CC=9)C9=CC=C2[N-]9[Co+2](N=78)([N-]56)N3=4)=CC=1)C |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids |
| | Cobalt tetramethoxyphenylporphyrin Usage And Synthesis |
| Description | [5,10,15,20-Tetrakis(4-methoxyphenyl)porphyrinato]cobalt(II) is a versatile metalloporphyrin compound with significant potential in various applications. It is widely used in photodynamic therapy (PDT) for cancer treatment, where it can absorb light and produce reactive oxygen species to target and destroy cancer cells. Additionally, it plays a crucial role in the development of solar cells, enhancing the efficiency of light absorption and energy conversion in photovoltaic devices. The compound also serves as a catalyst in various chemical reactions, particularly in organic synthesis, improving reaction rates and selectivity compared to traditional catalysts. Furthermore, it is employed in the creation of sensors for detecting environmental pollutants, leveraging its ability to interact with specific molecules for accurate measurements. Its unique porphyrin structure makes it valuable in academic research for studying the properties of metal-organic frameworks and their potential applications in drug delivery and materials science. | | Chemical Properties | PURPLE POWDER | | Uses | Tetrakis(4-methoxyphenyl)-21H,23H-porphine cobalt(II) is an organometallic complex used as an oxidation catalyst in a variety of synthetic reactions such as the selective oxidation of amines. | | Uses | Starting material in the synthesis of cobalt nitrosyl porphyrins for use in the study of the binding and activation of nitric oxide. | | General Description | Arsenite Ionophore I (5,10,15,20-tetrakis(4-methoxyphenyl)porphyrinatocobalt (TMOPP-Co)) can be synthesized by boiling a mixture of 5,10,15,20-tetrakis (4-methoxyphenyl)porphyrin (TMOPP) and cobalt acetate in glacial acetic acid. It has tendency towards attracting molybdate ions. | | reaction suitability | reagent type: catalyst
core: cobalt |
| | Cobalt tetramethoxyphenylporphyrin Preparation Products And Raw materials |
|