|
|
| | 3-Benzoylphenylacetonitrile Basic information |
| | 3-Benzoylphenylacetonitrile Chemical Properties |
| Boiling point | 406.2±28.0 °C(Predicted) | | density | 1.141±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | Chloroform (Sparingly), Methanol (Slightly) | | form | Solid | | color | Colourless to Light Yellow | | Major Application | pharmaceutical small molecule | | InChI | InChI=1S/C15H11NO/c16-10-9-12-5-4-8-14(11-12)15(17)13-6-2-1-3-7-13/h1-8,11H,9H2 | | InChIKey | MHKMCTCMEDUINO-UHFFFAOYSA-N | | SMILES | C1(CC#N)=CC=CC(C(=O)C2=CC=CC=C2)=C1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 2 |
| | 3-Benzoylphenylacetonitrile Usage And Synthesis |
| Chemical Properties | Yellow Oil | | Uses | Ketoprofen intermediate |
| | 3-Benzoylphenylacetonitrile Preparation Products And Raw materials |
|