| Company Name: |
Quality Control Solutions Ltd.
|
| Tel: |
0755-66853366 13670046396 |
| Email: |
orders@qcsrm.com |
| Products Intro: |
Product Name:Nedaplatin Impurity 1
CAS:41349-15-9
Purity:95% HPLC Package:10mg;25mg;50mg;100mg
|
| Company Name: |
Hubei Yangxin Medical Technology Co., Ltd.
|
| Tel: |
15374522761 |
| Email: |
3003392093@yongstandards.com |
| Products Intro: |
Product Name:Nedaplatin Impurity 1
CAS:41349-15-9
Purity:99%+ HPLC Package:10mg;25mg;50mg;100mg
|
|
| | Platinum (II), diammineoxalato-, cis- Basic information |
| | Platinum (II), diammineoxalato-, cis- Chemical Properties |
| InChI | InChI=1S/C2H2O4.2H2N.Pt/c3-1(4)2(5)6;;;/h(H,3,4)(H,5,6);2*1H2;/q;2*-1;+4/p-2 | | InChIKey | UZRHFHFYBOQKRZ-UHFFFAOYSA-L | | SMILES | N[Pt+2]1([O-]C(=O)C(=O)[O-]1)N |
| | Platinum (II), diammineoxalato-, cis- Usage And Synthesis |
| | Platinum (II), diammineoxalato-, cis- Preparation Products And Raw materials |
|