|
|
| | 4-(Trifluoromethyl)anisole Basic information |
| Product Name: | 4-(Trifluoromethyl)anisole | | Synonyms: | 1-(Trifluoromethyl)-4-methoxybenzene;1-Methoxy-4-(trifluoromethyl)benzene;4-(Trifluoromethyl)anisole ,98%;Benzene,1-Methoxy-4-(trifluoroMethyl)-;4-(Trifluoromethyl)anisole, 1-Methoxy-4-(trifluoromethyl)benzene, Methyl 4-(trifluoromethyl)phenyl ether;4-Methoxybenzotrifluoride[4-(TrifluoroMethyl)anisole];4-METHOXYBENZOTRIFLUORIDE;4-(TRIFLUOROMETHYL)ANISOLE | | CAS: | 402-52-8 | | MF: | C8H7F3O | | MW: | 176.14 | | EINECS: | | | Product Categories: | Anisoles, Alkyloxy Compounds & Phenylacetates;Fluorine Compounds | | Mol File: | 402-52-8.mol |  |
| | 4-(Trifluoromethyl)anisole Chemical Properties |
| Melting point | -9℃ | | Boiling point | 169℃/754mm | | density | 1.245 | | refractive index | 1.4450 | | Fp | 60°(140°F) | | storage temp. | 2-8°C | | form | Liquid | | color | Colorless to pale yellow | | InChI | InChI=1S/C8H7F3O/c1-12-7-4-2-6(3-5-7)8(9,10)11/h2-5H,1H3 | | InChIKey | CFIPQRIPCRRISV-UHFFFAOYSA-N | | SMILES | C1(OC)=CC=C(C(F)(F)F)C=C1 | | CAS DataBase Reference | 402-52-8(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 10 | | Safety Statements | 16-33 | | RIDADR | 1993 | | Hazard Note | Irritant | | HazardClass | 3 | | HS Code | 2909309090 |
| | 4-(Trifluoromethyl)anisole Usage And Synthesis |
| | 4-(Trifluoromethyl)anisole Preparation Products And Raw materials |
|