|
|
| | 1-Boc-4-ethynyl-4-fluoropiperidine Basic information |
| Product Name: | 1-Boc-4-ethynyl-4-fluoropiperidine | | Synonyms: | 1-Boc-4-ethynyl-4-fluoropiperidine;1-Piperidinecarboxylic acid, 4-ethynyl-4-fluoro-, 1,1-dimethylethyl ester;1-Boc-4-ethynyl-4-fluoropiperidine - [E13173];tert-butyl 4-ethynyl-4-fluoropiperidine-1-carboxylate | | CAS: | 191327-86-3 | | MF: | C12H18FNO2 | | MW: | 227.28 | | EINECS: | | | Product Categories: | | | Mol File: | 191327-86-3.mol |  |
| | 1-Boc-4-ethynyl-4-fluoropiperidine Chemical Properties |
| Melting point | 45 °C | | Boiling point | 264.5±40.0 °C(Predicted) | | density | 1.08±0.1 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | -3.91±0.40(Predicted) | | Appearance | Off-white to yellow Solid | | InChI | InChI=1S/C12H18FNO2/c1-5-12(13)6-8-14(9-7-12)10(15)16-11(2,3)4/h1H,6-9H2,2-4H3 | | InChIKey | DVGWDBGQOAGBTF-UHFFFAOYSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CCC(C#C)(F)CC1 |
| | 1-Boc-4-ethynyl-4-fluoropiperidine Usage And Synthesis |
| | 1-Boc-4-ethynyl-4-fluoropiperidine Preparation Products And Raw materials |
|