| Company Name: |
Beijing Concision Pharmaceutical Tech. Co.,Ltd Gold
|
| Tel: |
13501126834 |
| Email: |
2777085607@qq.com |
| Products Intro: |
Product Name:Cyanine3 maleimide
CAS:1838643-41-6
Purity:98%+HPLC Package:10mg/RMB 1500;50mg/RMB 4000;100mg/RMB 7000
|
Cyanine3 maleimide manufacturers
- Cyanine3 maleimide
-
- $0.00 / 25mg
-
2025-06-07
- CAS:1838643-41-6
- Min. Order: 25mg
- Purity: >99.00%
- Supply Ability: 25mg
|
| | Cyanine3 maleimide Basic information |
| Product Name: | Cyanine3 maleimide | | Synonyms: | Cyanine3 maleimide;Cyanine3 maleimide,Cy3 MAL;Cy3 maleimide chloride?Chemical Structure;2-(3-(1-(6-((2-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)ethyl)amino)-6-oxohexyl)-3,3-dimethylindolin-2-ylidene)prop-1-en-1-yl)-1,3,3-trimethyl-3H-indol-1-ium chloride | | CAS: | 1838643-41-6 | | MF: | C36H43ClN4O3 | | MW: | 615.22 | | EINECS: | | | Product Categories: | | | Mol File: | 1838643-41-6.mol |  |
| | Cyanine3 maleimide Chemical Properties |
| solubility | Soluble in DMSO, DMF, DCM | | form | Solid | | color | Light yellow to brown | | Appearance | red powder | | InChIKey | WONAOVDQEMKIMH-UHFFFAOYSA-N | | SMILES | C(N1C(C(C)(C)C2=CC=CC=C12)=CC=CC1C(C2=CC=CC=C2[N+]=1C)(C)C)CCCCC(=O)NCCN1C(C=CC1=O)=O.[Cl-] |
| | Cyanine3 maleimide Usage And Synthesis |
| Description | Cy3 maleimide is a mono-reactive dye containing maleimide group, which can selectively and efficiently attach Cyanine3 fluorophore(an analog of Cy3) to proteins and peptides containing cysteine residues, as well as to other thiolated molecules (such as thiol-containing oligonucleotides). Sulfo-Cy3 maleimide version is available for the labeling of antibodies and other sensitive proteins. | | Uses | Cy3 maleimide chloride is a dye derivative of Cyanine 3 (Cy3) (HY-D0822) containing maleimide functional groups. Cy3 is a fluorescent dye with a fluorescence spectrum typically in the green to orange wavelength range. The alkyne functional group of Cy3 maleimide chloride can undergo a "thiol-acrylamide" reaction with molecules containing sulfur-oxygen functional groups to form covalent bonds. Cy3 maleimide chloride can bind to biological molecules such as proteins and antibodies to track their location and dynamic changes in biological samples. | | Abs/Em Maxima | 555/570 nm | | Fluoresene quantum yield | 0.31 | | Extinction Coefficient | 150000 | | CF260 | 0.04 | | CF280 | 0.09 |
| | Cyanine3 maleimide Preparation Products And Raw materials |
|