| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 2,5-Bis(trifluoromethyl)fluorobenzene Basic information |
| Product Name: | 2,5-Bis(trifluoromethyl)fluorobenzene | | Synonyms: | 2-FLUORO-1,4-BIS(TRIFLUOROMETHYL)BENZENE;1,4-Bis(trifluoromethyl)-2-fluorobenzene 98%;alpha,alpha,alpha,alpha',alpha',alpha',2-Heptafluoro-p-xylene;1,4-Bis(trifluoromethyl)-2-fluorobenzene98%;Benzene, 2-fluoro-1,4-bis(trifluoromethyl)-;2,5-Bis(trifluoromethyl)fluorobenzene | | CAS: | 887268-08-8 | | MF: | C8H3F7 | | MW: | 232.1 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | 2,5-Bis(trifluoromethyl)fluorobenzene Chemical Properties |
| Boiling point | 50-54℃/60mm | | density | 1.444±0.06 g/cm3(Predicted) | | form | liquid | | color | Clear, colourless | | InChI | 1S/C8H3F7/c9-6-3-4(7(10,11)12)1-2-5(6)8(13,14)15/h1-3H | | InChIKey | KAGRJEBZBWYSJK-UHFFFAOYSA-N | | SMILES | FC(F)(F)c1c(cc(cc1)C(F)(F)F)F |
| Hazard Codes | Xi | | HazardClass | IRRITANT | | HS Code | 2903998090 | | Storage Class | 11 - Combustible Solids |
| | 2,5-Bis(trifluoromethyl)fluorobenzene Usage And Synthesis |
| | 2,5-Bis(trifluoromethyl)fluorobenzene Preparation Products And Raw materials |
|