| Company Name: |
Nanchang Chouhechem Pharmatech Co., Ltd. Gold
|
| Tel: |
18178918509 |
| Email: |
3296056070@qq.com |
| Products Intro: |
Product Name:Triphenylene-2,6,10-tricarboxylic acid
CAS:239455-23-3
Purity:98% Package:1克;5克
|
| Company Name: |
Zhengzhou Ruke Biological Co., Ltd.
|
| Tel: |
15981811963 |
| Email: |
1410472904@qq.com |
| Products Intro: |
Product Name:triphenylene-2,6,10-tricarboxylic acid
CAS:239455-23-3
Purity:97% Package:5g;25g;100g;1kg
|
|
| | triphenylene-2,6,10-tricarboxylic acid Basic information |
| | triphenylene-2,6,10-tricarboxylic acid Chemical Properties |
| Boiling point | 690.1±50.0 °C(Predicted) | | density | 1.570±0.06 g/cm3(Predicted) | | pka | 3.45±0.30(Predicted) | | InChI | InChI=1S/C21H12O6/c22-19(23)10-1-4-13-16(7-10)14-5-2-12(21(26)27)9-18(14)15-6-3-11(20(24)25)8-17(13)15/h1-9H,(H,22,23)(H,24,25)(H,26,27) | | InChIKey | ZOFZSXGOSAPAAV-UHFFFAOYSA-N | | SMILES | C1=C2C(C3C(C4C2=CC=C(C(O)=O)C=4)=CC=C(C(O)=O)C=3)=CC=C1C(O)=O |
| | triphenylene-2,6,10-tricarboxylic acid Usage And Synthesis |
| | triphenylene-2,6,10-tricarboxylic acid Preparation Products And Raw materials |
|