|
|
| | 3,5,6,7-tetrahydro-s-Indacen-1(2H)-one Basic information |
| Product Name: | 3,5,6,7-tetrahydro-s-Indacen-1(2H)-one | | Synonyms: | 3,5,6,7-tetrahydro-s-Indacen-1(2H)-one;2,3,6,7-tetrahydro-s-indacen-1(5H)-one(WXC05571);2,3,6,7-TETRAHYDRO-S-INDACEN-1(5H)-ONE;3,5,6,7-Tetrahydro-s-indacen-1-one;s-Indacen-1(2H)-one, 3,5,6,7-tetrahydro-;3,5,6,7-tetrahydro-2H-s-indacen-1-one;1,2,3,5,6,7-hexahydro-s-indacen-1-one | | CAS: | 14927-64-1 | | MF: | C12H12O | | MW: | 172.22 | | EINECS: | | | Product Categories: | | | Mol File: | 14927-64-1.mol |  |
| | 3,5,6,7-tetrahydro-s-Indacen-1(2H)-one Chemical Properties |
| Melting point | 80-81 °C | | Boiling point | 326.1±42.0 °C(Predicted) | | density | 1.195±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C12H12O/c13-12-5-4-10-6-8-2-1-3-9(8)7-11(10)12/h6-7H,1-5H2 | | InChIKey | LXDKNEXOGZDIAC-UHFFFAOYSA-N | | SMILES | C1(=O)C2=C(C=C3C(=C2)CCC3)CC1 |
| | 3,5,6,7-tetrahydro-s-Indacen-1(2H)-one Usage And Synthesis |
| Uses | 3,5,6,7-Tetrahydro-s-indacen-1-one, is an intermediate in the synthesis of 4-Nitro-3,5,6,7-tetrahydro-2H-S-indacen-1-one (N565125). |
| | 3,5,6,7-tetrahydro-s-Indacen-1(2H)-one Preparation Products And Raw materials |
|