- 3-HYDROXYDODECANOIC ACID
-
- $0.00 / 25KG
-
2025-08-08
- CAS:1883-13-2
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 50000KG/month
|
| | 3-HYDROXYDODECANOIC ACID Basic information |
| Product Name: | 3-HYDROXYDODECANOIC ACID | | Synonyms: | Dodecanoic acid,3-hydroxy-;3-HYDROXY C12:0 ACID;(+/-)-3-HYDROXYDODECANOIC ACID;3-HYDROXYDODECANOIC ACID;DL-BETA-HYDROXYLAURIC ACID;3-Hydroxydodecanoic acid, 98 %;3-hydroxylauricaci;3-Hydroxydodecanoic acid, 3-Hydroxy C12:0 derivative of lauric acid | | CAS: | 1883-13-2 | | MF: | C12H24O3 | | MW: | 216.32 | | EINECS: | | | Product Categories: | Acyclics, Miscellaneous Reagents | | Mol File: | 1883-13-2.mol |  |
| | 3-HYDROXYDODECANOIC ACID Chemical Properties |
| Melting point | 70-70.5 °C | | Boiling point | 113-115 °C(Press: 3 Torr) | | density | 0.987±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 4.38±0.10(Predicted) | | color | Pale Beige to Light Beige | | InChI | InChI=1S/C12H24O3/c1-2-3-4-5-6-7-8-9-11(13)10-12(14)15/h11,13H,2-10H2,1H3,(H,14,15) | | InChIKey | MUCMKTPAZLSKTL-UHFFFAOYSA-N | | SMILES | C(O)(=O)CC(O)CCCCCCCCC | | LogP | 3.110 (est) |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 |
| | 3-HYDROXYDODECANOIC ACID Usage And Synthesis |
| Uses | 3-hydroxydodecanoic acid is used in the study of Lipid A, a major constituent of the lipopolysaccharides, which are responsible for the toxicity of gram negative bacteria. Also used in the synthesis of olefins from β-hydroxy carboxylic acids. | | Uses | 3-Hydroxylauric Acid is used in the study of Lipid A, a major constituent of the lipopolysaccharides, which are responsible for the toxicity of gram negative bacteria. Also used in the synthesis of olefins from β-hydroxy carboxylic acids. | | Definition | ChEBI: A medium-chain fatty acid that is the 3-hydroxylated derivative of lauric acid; associated with fatty acid metabolic disorders. | | Biochem/physiol Actions | DL-3-Hydroxydodecanoic acid (3HDD) is a racemic mixture of D- and L-3HDD. 3-hydroxydodecanoic acid is found as a monomer in the construction of polyhydroxyalkanoates. 3HDD is used to study the roles of β-hydroxy fatty acids in chronic inflammation and insulin resistance and the biosynthesis of diffusible signal factors involved in quorum sensing. | | in vivo | 3-Hydroxydodecanoic acid (i.p., days 6, 9, and 12) shows anti-tumor effect via GPR84 activation and IL-12 production in mice carrying MC38 tumors[2].
. | Animal Model: | C57BL/6JRj mice carrying MC38 tumors[2] | | Dosage: | | | Administration: | Intraperitoneal injection (i.p.), days 6, 9, and 12 | | Result: | Showed a significant reduction in tumor growth.
Increased IL-12.
Exhibited higher infiltration of CD8+ T cells in tumors.
Was dependent on GPR84 receptor signaling.
Had a strong anti-tumor effect in combination with 5-FU.
|
| | IC 50 | Human Endogenous Metabolite |
| | 3-HYDROXYDODECANOIC ACID Preparation Products And Raw materials |
|