|
|
| | N-XantPhos Pd G4 Basic information |
| Product Name: | N-XantPhos Pd G4 | | Synonyms: | N-XantPhos Pd G4;C50H42N2O4P2PdS;(SP-4-4)-[4-(Diphenylphosphino-κP)-6-(diphenylphosphino)-10H-phenoxazine](methanesulfonato-κO)[2'-(methylamino-κN)[1,1'-biphenyl]-2-yl-κC]palladium;N-XantPhos Pd G4;N-XantPhos Pd G4 ChemBeads;(SP-4-4)-[4-(Diphenylphosphino-κP)-6-(diphenylphosphino)-10H-phenoxazine](methanesulfonate-κO)[2′-(methylamino-κN)[1,1′-biphenyl]-2-yl-κC]palladium | | CAS: | 1878105-23-7 | | MF: | C50H42N2O4P2PdS | | MW: | 935.32 | | EINECS: | | | Product Categories: | | | Mol File: | 1878105-23-7.mol |  |
| | N-XantPhos Pd G4 Chemical Properties |
| storage temp. | 2-8°C, stored under nitrogen | | form | powder or crystals | | Appearance | Light green to green Solid | | InChIKey | LQECMIPINHUTAN-UHFFFAOYSA-M | | SMILES | [MsO][Pd]1C2=CC=CC=C2C3=CC=CC=C3N1C.C4(P(C5=CC=CC=C5)C6=CC=CC=C6)=C(OC(C(P(C7=CC=CC=C7)C8=CC=CC=C8)=CC=C9)=C9N%10)C%10=CC=C4 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | N-XantPhos Pd G4 Usage And Synthesis |
| Uses | N-XantPhos Pd G4 is a fourth generation (G4) Buchwald precatalyst that is similar to the third generation (G3) precatalysts except that the amino group on the biphenyl backbone is methylated. This modification helps to prevent the limitations found when using the third generation precatalysts. It is air, moisture, and thermally-stable and shows good solubility in common organic solvents. | | reaction suitability | reagent type: catalyst |
| | N-XantPhos Pd G4 Preparation Products And Raw materials |
|