ICG amine manufacturers
- ICG-amine
-
- $0.00 / 25mg
-
2025-06-07
- CAS:1686147-55-6
- Min. Order: 25mg
- Purity: >99.00%
- Supply Ability: 25mg
|
| | ICG amine Basic information |
| | ICG amine Chemical Properties |
| solubility | Soluble in organic solvents such as DMF and methanol | | form | Solid | | color | Green to dark green | | Appearance | Green solid | | ε(extinction coefficient) | 155000 L⋅mol−1⋅cm−1 | | Φ(quantum yield) | 0.04 | | ex/em | 786/822nm (methanol/PBS) | | InChIKey | WKCQFHIAPMFCGN-UHFFFAOYSA-N | | SMILES | CC1(C(=[N+](CCCCS([O-])(=O)=O)C2C=CC3=CC=CC=C3C1=2)C=CC=CC=CC=C1C(C2C3=CC=CC=C3C=CC=2N1CCCCCC(=O)NCCCCCCN)(C)C)C |
| | ICG amine Usage And Synthesis |
| Chemical Properties | Appearance: Green solid
ex/em: 786/822nm (methanol/PBS)
Extinction coefficient (ε): 155000 Lmol1cm1
Quantum yield (Φ): 0.04 | | Uses | ICG amine, as a near-infrared fluorescent probe, binds to amino acid residues without condensing agents. ICG is a tricarbocyanine dye[1]. | | References | [1] Badaracco AG, et al. Indocyanine green modified silica shells for colon tumor marking. Appl Surf Sci. 2020;499:143885. DOI:10.1016/j.apsusc.2019.143885 |
| | ICG amine Preparation Products And Raw materials |
|