|
|
| | 6-METHYL-5-NITROQUINOLINE Basic information |
| | 6-METHYL-5-NITROQUINOLINE Chemical Properties |
| Melting point | 116-120 °C | | Boiling point | 330.5±27.0 °C(Predicted) | | density | 1.298±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | solid | | pka | 3.04±0.15(Predicted) | | Appearance | Light green to light brown Solid | | BRN | 154688 | | InChI | 1S/C10H8N2O2/c1-7-4-5-9-8(3-2-6-11-9)10(7)12(13)14/h2-6H,1H3 | | InChIKey | CENBTULRDDPOGR-UHFFFAOYSA-N | | SMILES | Cc1ccc2ncccc2c1[N+]([O-])=O |
| Hazard Codes | Xn | | Risk Statements | 68-41-37/38-22 | | Safety Statements | 26-36/37/39-39 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 3 | | HS Code | 2933499090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
| Provider | Language |
|
ALFA
| English |
| | 6-METHYL-5-NITROQUINOLINE Usage And Synthesis |
| Uses | 6-Methyl-5-nitroquinoline is a starter for fused indoles.1 |
| | 6-METHYL-5-NITROQUINOLINE Preparation Products And Raw materials |
|