|
|
| | 2,3,5,6-Tetrafluoro-4-hydroxy-benzoic acid Basic information |
| Product Name: | 2,3,5,6-Tetrafluoro-4-hydroxy-benzoic acid | | Synonyms: | TETRAFLUORO-4-HYDROXYBENZOIC ACID;ASISCHEM Z74677;2,3,5,6-TETRAFLUORO-4-HYDROXYBENZOIC ACID;4-HYDROXY-2,3,5,6-TETRAFLUOROBENZOIC ACID;AKOS BB-7901;2,3,5,6-tetrafluoro-4-hydroxybenzoate;2,3,5,6-TETRAFLUORO-4-HYDROXYBENZOIC ACID (TETRAFLUORO-4-HYDROXYBENZOIC ACID);2,3,5,6-Tetrafluoro-4-HydroxybenzoicAcid(Tetrafluoro-4-HydroxybenzoicAcid)210.09 | | CAS: | 652-34-6 | | MF: | C7H2F4O3 | | MW: | 210.08 | | EINECS: | 629-970-9 | | Product Categories: | | | Mol File: | 652-34-6.mol |  |
| | 2,3,5,6-Tetrafluoro-4-hydroxy-benzoic acid Chemical Properties |
| Melting point | 148-150°C | | Boiling point | 274.3±40.0 °C(Predicted) | | density | 1.792±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | solid | | pka | 2.03±0.10(Predicted) | | Appearance | White to off-white Solid | | Water Solubility | Insoluble in water. | | BRN | 986011 | | InChI | 1S/C7H2F4O3/c8-2-1(7(13)14)3(9)5(11)6(12)4(2)10/h12H,(H,13,14) | | InChIKey | FTLHGQOBAPTEHE-UHFFFAOYSA-N | | SMILES | OC(=O)c1c(F)c(F)c(O)c(F)c1F | | CAS DataBase Reference | 652-34-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-41-37/38 | | Safety Statements | 26-36/37/39-39-60-37 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | HS Code | 29182900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Dam. 1
Skin Irrit. 2
STOT SE 3 |
| Provider | Language |
|
ALFA
| English |
| | 2,3,5,6-Tetrafluoro-4-hydroxy-benzoic acid Usage And Synthesis |
| Uses | 2,3,5,6-tetrafluoro-4-hydroxy-benzoic acid be used as organic intermediates. | | Uses | 2,3,5,6-Tetrafluoro-4-hydroxybenzoic acid hydrate may be used in the preparation of new ligand, methyl 2,3,5,6-tetrafluoro-4-oxybenzoate (C8H3F4O3), combining an electron withdrawing group (C6F4) to tune the reactivity with an anchor group (CO2Me) for immobilization on supports. |
| | 2,3,5,6-Tetrafluoro-4-hydroxy-benzoic acid Preparation Products And Raw materials |
|