|
|
| | Potassium Amylxanthate Basic information |
| Product Name: | Potassium Amylxanthate | | Synonyms: | N-AMYLXANTHIC ACID POTASSIUM SALT;POTASSIUM O-AMYL DITHIOCARBONATE;POTASSIUM AMYLXANTHATE;Potassium n-amulxanthate;aeroxanthate;aeroxanthate350;amylpotassiumxanthate;carbonicacid,dithio-,o-pentylester,potassiumsalt | | CAS: | 2720-73-2 | | MF: | C6H13KOS2 | | MW: | 204.39 | | EINECS: | 220-329-5 | | Product Categories: | | | Mol File: | 2720-73-2.mol |  |
| | Potassium Amylxanthate Chemical Properties |
| Boiling point | 497.18℃[at 101 325 Pa] | | density | 1.24[at 20℃] | | vapor pressure | 0Pa at 25℃ | | storage temp. | Inert atmosphere,Room Temperature | | form | powder to crystal | | color | White to Orange to Green | | Odor | Strong unpleasant odor | | Water Solubility | very faint turbidity | | InChI | InChI=1S/C6H12OS2.K.H/c1-2-3-4-5-7-6(8)9;;/h2-5H2,1H3,(H,8,9);; | | InChIKey | URJAHDIEYARUPZ-UHFFFAOYSA-N | | SMILES | C(CCCC)OC(S)=S.[KH] | | LogP | -0.76 at 25℃ | | CAS DataBase Reference | 2720-73-2(CAS DataBase Reference) | | EPA Substance Registry System | Carbonodithioic acid, O-pentyl ester, potassium salt (1:1) (2720-73-2) |
| RIDADR | 3342 | | RTECS | FG1581900 | | TSCA | TSCA listed | | HS Code | 2930.90.9250 | | HazardClass | 4.2 | | PackingGroup | II | | Toxicity | LD50 intravenous in mouse: 99mg/kg |
| | Potassium Amylxanthate Usage And Synthesis |
| Chemical Properties | Potassium Amylxanthate is an organosulfur compound, pale yellow powder with a pungent odor, soluble in water. It is widely used in flotation processes used in the mining industry to separate ores. | | Uses | Potassium Amylxanthate can be used as collector in metal beneficiation. | | Preparation | Potassium amylxanthate is prepared by reacting n-amyl alcohol with CS2 and KOH.
CH3（CH2)4OH + CS2 + KOH→CH3（CH2)4OCS2K+H2O
| | General Description | Potassium amyl xanthate (PAX) is a widely used collector in the flotation of sulfide minerals, particularly for the flotation of copper, lead, and zinc ores. | | Flammability and Explosibility | Flammable |
| | Potassium Amylxanthate Preparation Products And Raw materials |
|