| Company Name: |
Rhawn Reagent Gold |
| Tel: |
400-1332688 18019345275 |
| Email: |
amy@rhawn.cn |
|
| | N,N'-bis(2,6-dimethylphenyl)ethanediamide Basic information |
| Product Name: | N,N'-bis(2,6-dimethylphenyl)ethanediamide | | Synonyms: | N,N'-bis(2,6-dimethylphenyl)ethanediamide;N,N’-bis(2,6-dimethylphenyl)oxalamide;Ethanediamide, N1,N2-bis(2,6-dimethylphenyl)-;N,N'-bis(2,6-dimethylphenyl)oxamide;N1,N2-Bis(2,6-dimethylphenyl)ethanediamide;N,N’-2,6-dimethylphenyl-oxamide;N1,N1-bis(2,6-dimethylphenyl)amide;N1,N2-bis(2,6-dimethylphenyl)oxalamide | | CAS: | 91325-47-2 | | MF: | C18H20N2O2 | | MW: | 296.36 | | EINECS: | | | Product Categories: | | | Mol File: | 91325-47-2.mol |  |
| | N,N'-bis(2,6-dimethylphenyl)ethanediamide Chemical Properties |
| Melting point | 264-265 °C | | density | 1.192±0.06 g/cm3(Predicted) | | pka | 11.12±0.70(Predicted) | | InChI | InChI=1S/C18H20N2O2/c1-11-7-5-8-12(2)15(11)19-17(21)18(22)20-16-13(3)9-6-10-14(16)4/h5-10H,1-4H3,(H,19,21)(H,20,22) | | InChIKey | FFXRRIHTEGUDCH-UHFFFAOYSA-N | | SMILES | C(NC1=C(C)C=CC=C1C)(=O)C(NC1=C(C)C=CC=C1C)=O |
| | N,N'-bis(2,6-dimethylphenyl)ethanediamide Usage And Synthesis |
| | N,N'-bis(2,6-dimethylphenyl)ethanediamide Preparation Products And Raw materials |
|