- 3-Fluorophenylboronic acid
-
- $34.00 / 1kg
-
2025-09-25
- CAS:768-35-4
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | 3-Fluorophenylboronic acid Basic information |
| | 3-Fluorophenylboronic acid Chemical Properties |
| Melting point | 214-218 °C (lit.) | | Boiling point | 271.4±42.0 °C(Predicted) | | density | 1.24±0.1 g/cm3(Predicted) | | vapor pressure | 0Pa at 20℃ | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | Crystalline Powder | | pka | 7.50±0.10(Predicted) | | color | White to off-white | | Water Solubility | 27.1g/L at 20℃ | | BRN | 3030632 | | InChI | InChI=1S/C6H6BFO2/c8-6-3-1-2-5(4-6)7(9)10/h1-4,9-10H | | InChIKey | KNXQDJCZSVHEIW-UHFFFAOYSA-N | | SMILES | B(C1=CC=CC(F)=C1)(O)O | | LogP | 2 at 23℃ | | CAS DataBase Reference | 768-35-4(CAS DataBase Reference) |
| | 3-Fluorophenylboronic acid Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powder | | Uses | suzuki reaction | | Uses | Recently used to make novel liquid crystalline fluorobiphenylcyclohexenes and difluoroterphenyls by palladium-catalyzed cross-couplings also used in the synthesis of o-phenylphenols as potent leukotriene B4 receptor agonists. | | Uses | Intermediates of Liquid Crystals | | Flammability and Explosibility | Not classified |
| | 3-Fluorophenylboronic acid Preparation Products And Raw materials |
|