- 1,2,4-Triazinone
-
- $0.00 / 1Kg
-
2024-12-24
- CAS:33509-43-2
- Min. Order: 1Kg
- Purity: 99.99%
- Supply Ability: 20 tons
|
| | 4-Amino-6-(tert-butyl)-3-mercapto-1,2,4-triazin-5(4H)-one Basic information |
| Product Name: | 4-Amino-6-(tert-butyl)-3-mercapto-1,2,4-triazin-5(4H)-one | | Synonyms: | 4-triazin-5(2h)-one,4-amino-6-(1,1-dimethylethyl)-3,4-dihydro-3-thioxo-2;BUTTPARK 22\07-82;4-AMINO-6-(TERT-BUTYL)-3-MERCAPTO-4,5-DIHYDRO-1,2,4-TRIAZIN-5-ONE;4-amino-6-tert-butyl-3-mercapto-1,2,4-triazin-5(4H)-one;4-AMINO-6-(1,1DIMETHYLETHYL)-3,4-DIHYDRO-3-THIOXO-1,2,4-TRIAZIN-5(2H)-ONE;4-Amino-3-mercapto-6-tert-butyl-1,2,4-triazine-5(4H)-one;4-amino-6-tert-butyl-3-sulfanylidene-2H-1,2,4-triazin-5-one;1,2,4-Triazinone 4-Amino-6-(tert-butyl)-3-mercapto-1,2,4-triazin-5(4H)-one | | CAS: | 33509-43-2 | | MF: | C7H12N4OS | | MW: | 200.26 | | EINECS: | 251-548-4 | | Product Categories: | | | Mol File: | 33509-43-2.mol |  |
| | 4-Amino-6-(tert-butyl)-3-mercapto-1,2,4-triazin-5(4H)-one Chemical Properties |
| Melting point | 215 °C(Solv: acetone (67-64-1); toluene (108-88-3)) | | Boiling point | 284.7±23.0 °C(Predicted) | | density | 1.40±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | solubility | Acetonitrile (Slightly), Chloroform (Slightly) | | pka | 15.20±0.40(Predicted) | | form | Solid | | color | White to Off-White | | InChI | InChI=1S/C7H12N4OS/c1-7(2,3)4-5(12)11(8)6(13)10-9-4/h8H2,1-3H3,(H,10,13) | | InChIKey | OFKAVNQBCRJBJE-UHFFFAOYSA-N | | SMILES | N1=C(C(C)(C)C)C(=O)N(N)C(=S)N1 | | EPA Substance Registry System | 1,2,4-Triazin-5(2H)-one, 4-amino-6-(1,1-dimethylethyl)-3,4-dihydro-3-thioxo- (33509-43-2) |
| Hazard Codes | Xi | | Hazard Note | Irritant | | TSCA | TSCA listed | | HS Code | 2933698090 |
| | 4-Amino-6-(tert-butyl)-3-mercapto-1,2,4-triazin-5(4H)-one Usage And Synthesis |
| Chemical Properties | White powder |
| | 4-Amino-6-(tert-butyl)-3-mercapto-1,2,4-triazin-5(4H)-one Preparation Products And Raw materials |
|