|
|
| | 4-CHLORO-4'-METHYLBENZOPHENONE Basic information |
| Product Name: | 4-CHLORO-4'-METHYLBENZOPHENONE | | Synonyms: | METHANONE,(4-CHLOROPHENYL);Methanone, (4-chlorophenyl)(4-Methylphenyl)-;(4-chlorophenyl)(p-tolyl)Methanone;4-Chlorophenyl 4-methylphenyl ketone;NSC 29;4-(4-chlorophenyl)(p-tolyl)methanone;4-methylphenyl methanone;4-Chloro-4'-methylbenzophenone | | CAS: | 5395-79-9 | | MF: | C14H11ClO | | MW: | 230.69 | | EINECS: | 255-627-4 | | Product Categories: | | | Mol File: | 5395-79-9.mol |  |
| | 4-CHLORO-4'-METHYLBENZOPHENONE Chemical Properties |
| Melting point | 128.5-129 °C | | Boiling point | 364.5±25.0 °C(Predicted) | | density | 1.178±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | InChI | InChI=1S/C14H11ClO/c1-10-2-4-11(5-3-10)14(16)12-6-8-13(15)9-7-12/h2-9H,1H3 | | InChIKey | MRIBPIAKCVDXLY-UHFFFAOYSA-N | | SMILES | C(C1=CC=C(Cl)C=C1)(C1=CC=C(C)C=C1)=O |
| | 4-CHLORO-4'-METHYLBENZOPHENONE Usage And Synthesis |
| Uses | 4-Chloro-4''-methylbenzophenone is a useful synthetic compound. |
| | 4-CHLORO-4'-METHYLBENZOPHENONE Preparation Products And Raw materials |
|