| Company Name: |
TargetMol |
| Tel: |
400-821-0310 15002144251 |
| Email: |
xuexiang.shao@tsbiochem.com |
|
| | 5-(4-chlorophenyl)-1,2-oxazole-4-carboxylic acid Basic information |
| | 5-(4-chlorophenyl)-1,2-oxazole-4-carboxylic acid Chemical Properties |
| Boiling point | 398.7±27.0 °C(Predicted) | | density | 1.440±0.06 g/cm3(Predicted) | | pka | 2.85±0.36(Predicted) | | form | solid | | InChI | 1S/C10H6ClNO3/c11-7-3-1-6(2-4-7)9-8(10(13)14)5-12-15-9/h1-5H,(H,13,14) | | InChIKey | QYWAKMRGJVKMRO-UHFFFAOYSA-N | | SMILES | O=C(O)C1=C(C2=CC=C(Cl)C=C2)ON=C1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 5-(4-chlorophenyl)-1,2-oxazole-4-carboxylic acid Usage And Synthesis |
| | 5-(4-chlorophenyl)-1,2-oxazole-4-carboxylic acid Preparation Products And Raw materials |
|