2-Hexyl-1-octanol manufacturers
|
| | 2-Hexyl-1-octanol Basic information |
| Product Name: | 2-Hexyl-1-octanol | | Synonyms: | 1-Octanol, 2-hexyl-;2-Hexyloctanol;2-Hexyloctyl alcohol;2-Hexyl-1-n-octanol;2-hexyloctan-1-ol;2-Hexyl-n-octyl Alcohol;2-Hexyl-1-octanol | | CAS: | 19780-79-1 | | MF: | C14H30O | | MW: | 214.39 | | EINECS: | | | Product Categories: | | | Mol File: | 19780-79-1.mol |  |
| | 2-Hexyl-1-octanol Chemical Properties |
| Boiling point | 162°C/15mmHg(lit.) | | density | 0.832±0.06 g/cm3(Predicted) | | refractive index | 1.4440 to 1.4480 | | pka | 15.13±0.10(Predicted) | | form | clear liquid | | color | Colorless to Almost colorless | | InChI | InChI=1S/C14H30O/c1-3-5-7-9-11-14(13-15)12-10-8-6-4-2/h14-15H,3-13H2,1-2H3 | | InChIKey | QNMCWJOEQBZQHB-UHFFFAOYSA-N | | SMILES | C(O)C(CCCCCC)CCCCCC |
| | 2-Hexyl-1-octanol Usage And Synthesis |
| Definition | ChEBI: 2-Hexyl-1-octanol is an aliphatic alcohol. |
| | 2-Hexyl-1-octanol Preparation Products And Raw materials |
|