|
|
| | 2-Amino-5-phenyl-3-thiophenecarboxylic acid Basic information |
| | 2-Amino-5-phenyl-3-thiophenecarboxylic acid Chemical Properties |
| Melting point | 190 °C(Solv: ethanol (64-17-5)) | | Boiling point | 450.5±45.0 °C(Predicted) | | density | 1.378±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 5.41±0.30(Predicted) | | form | solid | | Appearance | Light brown to brown Solid | | InChI | 1S/C11H9NO2S/c12-10-8(11(13)14)6-9(15-10)7-4-2-1-3-5-7/h1-6H,12H2,(H,13,14) | | InChIKey | QSMQLBVCCAMZHD-UHFFFAOYSA-N | | SMILES | Nc1sc(cc1C(O)=O)-c2ccccc2 |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | HS Code | 2934999090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 2-Amino-5-phenyl-3-thiophenecarboxylic acid Usage And Synthesis |
| | 2-Amino-5-phenyl-3-thiophenecarboxylic acid Preparation Products And Raw materials |
|