Methyl 3-methoxybenzoate manufacturers
|
| | Methyl 3-methoxybenzoate Basic information |
| | Methyl 3-methoxybenzoate Chemical Properties |
| Boiling point | 88-90°C 1mm | | density | 1,15 g/cm3 | | refractive index | 1.5270 | | Fp | 238°C | | storage temp. | Sealed in dry,Room Temperature | | form | clear liquid | | color | Colorless to Almost colorless | | Specific Gravity | 1.15 | | BRN | 2208567 | | InChI | InChI=1S/C9H10O3/c1-11-8-5-3-4-7(6-8)9(10)12-2/h3-6H,1-2H3 | | InChIKey | DUKYPQBGYRJVAN-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C1=CC=CC(OC)=C1 | | LogP | 2.080 (est) | | CAS DataBase Reference | 5368-81-0(CAS DataBase Reference) | | NIST Chemistry Reference | 3-CH3O-C6H4-COOCH3(5368-81-0) |
| Safety Statements | 24/25-23 | | WGK Germany | 3 | | HS Code | 29189900 |
| Provider | Language |
|
ALFA
| English |
| | Methyl 3-methoxybenzoate Usage And Synthesis |
| | Methyl 3-methoxybenzoate Preparation Products And Raw materials |
|