- Vinyltriacetoxysilane
-
- $10.00
-
2024-04-23
- CAS:4130-08-9
- Min. Order: 1kg
- Purity: 99.6%
- Supply Ability: 100000
|
| | Vinyltriacetoxysilane Chemical Properties |
| Melting point | 7 °C | | Boiling point | 175 °C/10 mmHg (lit.) | | density | 1.167 g/mL at 25 °C (lit.) | | vapor pressure | 1.47Pa at 20℃ | | refractive index | n20/D 1.422(lit.) | | Fp | >230 °F | | storage temp. | 2-8°C | | form | liquid | | Specific Gravity | 1.167 (20℃) | | color | colorless to pale yellow | | Odor | Mild odor | | Water Solubility | Insoluble in water. | | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | | Sensitive | Moisture Sensitive | | BRN | 1792454 | | InChI | 1S/C8H12O6Si/c1-5-15(12-6(2)9,13-7(3)10)14-8(4)11/h5H,1H2,2-4H3 | | InChIKey | NOZAQBYNLKNDRT-UHFFFAOYSA-N | | SMILES | CC(=O)O[Si](OC(C)=O)(OC(C)=O)C=C | | LogP | 0.6 | | CAS DataBase Reference | 4130-08-9(CAS DataBase Reference) | | NIST Chemistry Reference | Triacetoxy(vinyl)silane(4130-08-9) | | EPA Substance Registry System | Vinylsilanetriol triacetate (4130-08-9) |
| Hazard Codes | C | | Risk Statements | 34-37-14 | | Safety Statements | 26-36/37/39-45-8 | | RIDADR | UN 3265 8/PG 2 | | WGK Germany | 3 | | F | 10-21 | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | III | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | Vinyltriacetoxysilane Usage And Synthesis |
| General Description | Vinyltriacetoxysilane is a clear to yellowish liquid with acrid odor of acetic acid (vinegar). It hydrolyzes in the presence of moisture (acetic acid is released) to form silanols, which can react with themselves to pro-duce siloxanes or bind to inorganic substrates.
| | Description | Vinyltriacetoxysilane is an organosilicon compound used in various industrial applications due to its ability to act as a coupling agent and crosslinking agent.
| | Chemical Properties | Colorless or yellowish transparent liquid | | Flammability and Explosibility | Not classified |
| | Vinyltriacetoxysilane Preparation Products And Raw materials |
|