|
|
| | Barium bis(2,2,6,6-tetramethyl-3,5-heptanedionate) hydrate Basic information |
| Product Name: | Barium bis(2,2,6,6-tetramethyl-3,5-heptanedionate) hydrate | | Synonyms: | BIS(2,2,6,6-TETRAMETHYL-3,5-HEPTANEDIONATO)BARIUM HYDRATE;BIS(2,2,6,6-TETRAMETHYL-3,5 HEPTANEDIONATO)BARIUM(II);BIS(2,2,6,6-TETRAMETHYL-3,5-HEPTANEDIONATO)BARIUM N-HYDRATE;BARIUM (2,2,6,6-TETRAMETHYL-3,5-HEPTANEDIONATE) TETRAMER;BARIUM BIS-2,2,6,6-TETRAMETHYL-3,5-HEPTANEDIONATE;BARIUM BIS(2,2,6,6-TETRAMETHYL-3,5-HEPTANEDIONATE) HYDRATE;BARIUM BIS(2,2,6,6-TETRAMETHYLHEPTANE-3,5-DIONE);Bis(2,2,6,6-tetramethyl-3,5-heptanedionato)barium hydrate Ba(tmhd)2.H20 | | CAS: | 17594-47-7 | | MF: | C22H38BaO4 | | MW: | 503.87 | | EINECS: | | | Product Categories: | Other Metal;metal beta-diketonate complexes | | Mol File: | 17594-47-7.mol |  |
| | Barium bis(2,2,6,6-tetramethyl-3,5-heptanedionate) hydrate Chemical Properties |
| Melting point | 175-180 °C(lit.) | | Boiling point | 225°C 0,05mm | | Fp | 225°C/0.3mm | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | Powder | | color | white | | Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions | | Sensitive | Hygroscopic | | InChI | 1S/2C11H20O2.Ba.H2O/c2*1-10(2,3)8(12)7-9(13)11(4,5)6;;/h2*7,12H,1-6H3;;1H2/q;;+2;/p-2/b2*8-7-;; | | InChIKey | VCALGUJWYYNHDY-ZJCTYWPYSA-L | | SMILES | [H]O[H].CC(C)(C)C(=O)\C=C(/O[Ba]O\C(=C/C(=O)C(C)(C)C)C(C)(C)C)C(C)(C)C | | CAS DataBase Reference | 17594-47-7(CAS DataBase Reference) |
| Hazard Codes | Xn,T | | Risk Statements | 20/22-36/37/38-23/24/25 | | Safety Statements | 28-45-36/37-26 | | RIDADR | UN1564 | | WGK Germany | 1 | | TSCA | No | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 2805191000 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Barium bis(2,2,6,6-tetramethyl-3,5-heptanedionate) hydrate Usage And Synthesis |
| Chemical Properties | used in the preparation of superconducting thin films [ALD94] | | Uses | MOCVD of superconductors | | reaction suitability | core: barium |
| | Barium bis(2,2,6,6-tetramethyl-3,5-heptanedionate) hydrate Preparation Products And Raw materials |
|