|
|
| | DITRIDECYL 3,3'-THIODIPROPIONATE Basic information |
| | DITRIDECYL 3,3'-THIODIPROPIONATE Chemical Properties |
| Boiling point | 602.7±40.0 °C(Predicted) | | density | 0.936 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.47(lit.) | | Fp | >230 °F | | Cosmetics Ingredients Functions | ANTIOXIDANT | | Cosmetic Ingredient Review (CIR) | DITRIDECYL 3,3'-THIODIPROPIONATE (10595-72-9) | | InChI | InChI=1S/C32H62O4S/c1-3-5-7-9-11-13-15-17-19-21-23-27-35-31(33)25-29-37-30-26-32(34)36-28-24-22-20-18-16-14-12-10-8-6-4-2/h3-30H2,1-2H3 | | InChIKey | MZHULIWXRDLGRR-UHFFFAOYSA-N | | SMILES | S(CCC(OCCCCCCCCCCCCC)=O)CCC(OCCCCCCCCCCCCC)=O | | LogP | 12.935 (est) | | EPA Substance Registry System | Propanoic acid, 3,3'-thiobis-, 1,1'-ditridecyl ester (10595-72-9) |
| WGK Germany | 1 | | TSCA | TSCA listed |
| | DITRIDECYL 3,3'-THIODIPROPIONATE Usage And Synthesis |
| | DITRIDECYL 3,3'-THIODIPROPIONATE Preparation Products And Raw materials |
|