| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 2-Chloro-6-methoxybenzothiazole Basic information |
| | 2-Chloro-6-methoxybenzothiazole Chemical Properties |
| Melting point | 52-56 °C | | Boiling point | 133 °C / 7mmHg | | density | 1.404±0.06 g/cm3(Predicted) | | Fp | 110 °C | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 0.53±0.10(Predicted) | | form | powder to crystal | | color | White to Orange to Green | | InChI | InChI=1S/C8H6ClNOS/c1-11-5-2-3-6-7(4-5)12-8(9)10-6/h2-4H,1H3 | | InChIKey | FVUFTABOJFRHSU-UHFFFAOYSA-N | | SMILES | S1C2=CC(OC)=CC=C2N=C1Cl | | CAS DataBase Reference | 2605-14-3(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 22-36 | | Safety Statements | 22-26 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29349990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
| | 2-Chloro-6-methoxybenzothiazole Usage And Synthesis |
| Chemical Properties | White solid |
| | 2-Chloro-6-methoxybenzothiazole Preparation Products And Raw materials |
|