|
|
| | FMOC-GLY-PRO-OH Basic information |
| Product Name: | FMOC-GLY-PRO-OH | | Synonyms: | FMOC-GLY-PRO-OH;FMOC-GLYCYL-L-PROLINE;Fmoc-Gly-Pro-OH≥ 98% (HPLC);Fmoc-gycyl-L-proline;(9H-Fluoren-9-yl)MethOxy]Carbonyl Gly-Pro-OH;N-(9H-fluoren-9-ylmethoxycarbonyl)glycyl-L-proline;(2S)-1-[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)acetyl]pyrrolidine-2-carboxylic acid;L-Proline, N-[(9H-fluoren-9-ylmethoxy)carbonyl]glycyl- | | CAS: | 212651-48-4 | | MF: | C22H22N2O5 | | MW: | 394.42 | | EINECS: | | | Product Categories: | Amino Acid Derivatives | | Mol File: | Mol File |  |
| | FMOC-GLY-PRO-OH Chemical Properties |
| Boiling point | 676.5±55.0 °C(Predicted) | | density | 1.346±0.06 g/cm3(Predicted) | | storage temp. | -15°C | | pka | 3.50±0.20(Predicted) | | form | solid | | InChI | 1S/C22H22N2O5/c25-20(24-11-5-10-19(24)21(26)27)12-23-22(28)29-13-18-16-8-3-1-6-14(16)15-7-2-4-9-17(15)18/h1-4,6-9,18-19H,5,10-13H2,(H,23,28)(H,26,27)/t19-/m0/s1 | | InChIKey | HPTFPWMPQFBSHP-IBGZPJMESA-N | | SMILES | OC(=O)[C@@H]1CCCN1C(=O)CNC(=O)OCC2c3ccccc3-c4ccccc24 |
| WGK Germany | WGK 3 | | HS Code | 2933998090 | | Storage Class | 11 - Combustible Solids |
| | FMOC-GLY-PRO-OH Usage And Synthesis |
| Chemical Properties | White to off-white powder |
| | FMOC-GLY-PRO-OH Preparation Products And Raw materials |
|