| Company Name: |
Shanghai Forever Synthesis Co.,Ltd Gold
|
| Tel: |
18096642264; 18096642264 |
| Email: |
sales01@foreversyn.com |
| Products Intro: |
Product Name:Fluvoxamine EP Impurity B
CAS:89035-92-7
Purity:95% HPLC Package:10mg;25mg;50mg;100mg;250mg
|
|
| | Fluvoxamine EP Impurity B Maleate Basic information |
| Product Name: | Fluvoxamine EP Impurity B Maleate | | Synonyms: | 2-[(Z)-[5-methoxy-1-[4-(trifluoromethyl)phenyl]pentylidene]amino]oxyethanamine;Fluvoxamine Maleate EP Impurity B;1-Pentanone, 5-methoxy-1-[4-(trifluoromethyl)phenyl]-, O-(2-aminoethyl)oxime, (1Z)-;Fluvoxamine, (Z)-;2-[[[(1Z)-5-Methoxy-1-[4-(trifluoromethyl)phenyl]pentylidene]amino]oxy]ethanamine;1-Pentanone, 5-methoxy-1-[4-(trifluoromethyl)phenyl]-,O-(2-aminoethyl)oxime, (Z)-;(Z)-5-Methoxy-1-(4-(trifluoromethyl)phenyl)pentan-1-one O-(2-aminoethyl) oxime (Fluvoxamine Impurity);Fluvoxamine maleate-Z-Isomers | | CAS: | 89035-92-7 | | MF: | C15H21F3N2O2 | | MW: | 318.33 | | EINECS: | | | Product Categories: | | | Mol File: | 89035-92-7.mol |  |
| | Fluvoxamine EP Impurity B Maleate Chemical Properties |
| Boiling point | 370.6±52.0 °C(Predicted) | | density | 1.16±0.1 g/cm3(Predicted) | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 9.39±0.10(Predicted) | | form | Thick Oil to Solid | | color | Pale Yellow to Yellow | | InChI | InChI=1S/C15H21F3N2O2/c1-21-10-3-2-4-14(20-22-11-9-19)12-5-7-13(8-6-12)15(16,17)18/h5-8H,2-4,9-11,19H2,1H3/b20-14- | | InChIKey | CJOFXWAVKWHTFT-ZHZULCJRSA-N | | SMILES | C(=N/OCCN)(/C1=CC=C(C(F)(F)F)C=C1)\CCCCOC |
| | Fluvoxamine EP Impurity B Maleate Usage And Synthesis |
| Uses | The geometric isomer of the second-generation antidepressant Fluvoxamine. | | Definition | ChEBI: 2-[[5-methoxy-1-[4-(trifluoromethyl)phenyl]pentylidene]amino]oxyethanamine is a member of (trifluoromethyl)benzenes. |
| | Fluvoxamine EP Impurity B Maleate Preparation Products And Raw materials |
|