- 6-ROX
-
- $46.00
-
2026-07-15
- CAS:194785-18-7
- Purity: 98.33%
- Supply Ability: 10g
|
| | 6-CARBOXY-X-RHODAMINE Basic information |
| Product Name: | 6-CARBOXY-X-RHODAMINE | | Synonyms: | 6-CARBOXY-X-RHODAMINE;6-CARBOXY-X-RHODAMINE, FOR FLUORESCENCE*;6-CARBOXY-X-RHODAMINE (SINGLE ISOMER);6-carboxy-X-rhodaMine, triethylaMMoniuM salt;6-ROX, 6-CXR;6-ROX [6-Carboxy-X-RhodaMine];1H,5H,11H,15H-Xantheno[2,3,4-ij:5,6,7-i'j']diquinolizin-18-ium,9-(2,5-dicarboxyphenyl)-2,3,6,7,12,13,16,17-octahydro-, inner salt;6-ROX?Acid | | CAS: | 194785-18-7 | | MF: | C33H30N2O5 | | MW: | 534.61 | | EINECS: | | | Product Categories: | ROX;FLUOROPHORES | | Mol File: | 194785-18-7.mol |  |
| | 6-CARBOXY-X-RHODAMINE Chemical Properties |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C | | solubility | DMSO: soluble | | form | Solid | | color | Brown to black | | InChIKey | WQZIDRAQTRIQDX-UHFFFAOYSA-N | | SMILES | C(C1C=CC(C(=O)O)=CC=1C1=C2C=C3CCCN4CCCC(=C34)C2=[O+]C2=C3CCCN4CCCC(=C34)C=C12)(=O)[O-] |
| | 6-CARBOXY-X-RHODAMINE Usage And Synthesis |
| Uses | 6-Carboxy-X-rhodamine is a single isomer, long wavelength rhodamine dye. | | Uses | 6-Carboxy-X-rhodamine is a rhodamine based dye for use in tracer agents, laser dyes, labeling agents for biologics, etc. |
| | 6-CARBOXY-X-RHODAMINE Preparation Products And Raw materials |
|