- 1-ETHYNYLCYCLOPENTANOL
-
- $1.00 / 1KG
-
2020-01-03
- CAS:17356-19-3
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 200kg
|
| | 1-ETHYNYLCYCLOPENTANOL Basic information |
| | 1-ETHYNYLCYCLOPENTANOL Chemical Properties |
| Melting point | 27 °C | | Boiling point | 156-159 °C(lit.) | | density | 0.962 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.474(lit.) | | Fp | 120 °F | | storage temp. | Sealed in dry,2-8°C | | pka | 13.34±0.20(Predicted) | | Appearance | Colorless to light yellow Liquid | | Water Solubility | Insoluble in water. | | BRN | 1924167 | | InChI | InChI=1S/C7H10O/c1-2-7(8)5-3-4-6-7/h1,8H,3-6H2 | | InChIKey | LQMDOONLLAJAPZ-UHFFFAOYSA-N | | SMILES | C1(C#C)(O)CCCC1 | | CAS DataBase Reference | 17356-19-3(CAS DataBase Reference) | | EPA Substance Registry System | Cyclopentanol, 1-ethynyl- (17356-19-3) |
| Hazard Codes | Xi | | Risk Statements | 10-36/37 | | Safety Statements | 16-26-27-36/37/39 | | RIDADR | UN 1986 3/PG 3 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | 3 | | PackingGroup | III | | HS Code | 29061990 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Irrit. 2
Flam. Liq. 3
STOT SE 3 |
| | 1-ETHYNYLCYCLOPENTANOL Usage And Synthesis |
| Chemical Properties | clear colorless to yellow liquid after melting | | Uses | 1-Ethynylcyclopentanol is used in organic synthesis. | | Synthesis Reference(s) | Synthetic Communications, 18, p. 131, 1988 DOI: 10.1080/00397918808077336 |
| | 1-ETHYNYLCYCLOPENTANOL Preparation Products And Raw materials |
|