|
|
| | S-(Octanoyl)mercaptopropyltriethoxysilane Basic information |
| Product Name: | S-(Octanoyl)mercaptopropyltriethoxysilane | | Synonyms: | S-(OCTANOYL)MERCAPTOPROPYLTRIETHOXYSILANE;S-[3-(Triethoxysilyl)propyl] octanethioate;3-Octanoylthiopropyltriethoxysilane;3-Triethoxysilyl-1-propyl thiooctanoate;A-Link 599;NXT;NXT Silane;Silquest A-Link 599 | | CAS: | 220727-26-4 | | MF: | C17H36O4SSi | | MW: | 364.62 | | EINECS: | 436-690-9 | | Product Categories: | | | Mol File: | 220727-26-4.mol |  |
| | S-(Octanoyl)mercaptopropyltriethoxysilane Chemical Properties |
| Boiling point | 390.2±25.0 °C(Predicted) | | density | 0,969 g/cm3 | | vapor pressure | 0.002Pa at 25℃ | | refractive index | 1.4515 | | Fp | 176°C | | Specific Gravity | 0.9686 | | Water Solubility | 536μg/L at 20℃ | | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | | InChI | InChI=1S/C17H36O4SSi/c1-5-9-10-11-12-14-17(18)22-15-13-16-23(19-6-2,20-7-3)21-8-4/h5-16H2,1-4H3 | | InChIKey | JPPLPDOXWBVPCW-UHFFFAOYSA-N | | SMILES | C(SCCC[Si](OCC)(OCC)OCC)(=O)CCCCCCC | | LogP | 4.2 at 20℃ | | EPA Substance Registry System | Octanethioic acid, S-[3-(triethoxysilyl)propyl] ester (220727-26-4) |
| | S-(Octanoyl)mercaptopropyltriethoxysilane Usage And Synthesis |
| Flammability and Explosibility | Non flammable |
| | S-(Octanoyl)mercaptopropyltriethoxysilane Preparation Products And Raw materials |
|