|
|
| | Boc-N-alpha-methyl-O-benzyl-L-tyrosine Basic information |
| | Boc-N-alpha-methyl-O-benzyl-L-tyrosine Chemical Properties |
| Melting point | 130-134 °C | | Boiling point | 533.0±50.0 °C(Predicted) | | density | 1.174±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | Powder | | pka | 3.00±0.10(Predicted) | | InChI | InChI=1S/C22H27NO5/c1-22(2,3)28-21(26)23(4)19(20(24)25)14-16-10-12-18(13-11-16)27-15-17-8-6-5-7-9-17/h5-13,19H,14-15H2,1-4H3,(H,24,25)/t19-/m0/s1 | | InChIKey | FSNRGORPOYPIJC-IBGZPJMESA-N | | SMILES | C(O)(=O)[C@H](CC1=CC=C(OCC2=CC=CC=C2)C=C1)N(C(OC(C)(C)C)=O)C | | CAS DataBase Reference | 64263-81-6(CAS DataBase Reference) |
| WGK Germany | 3 | | HazardClass | IRRITANT |
| | Boc-N-alpha-methyl-O-benzyl-L-tyrosine Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | Boc-N-methyl-O-benzyl-L-tyrosine is used in total synthesis of marine-derived elastase inhibitor lyngbyastatin 7, and its evaluation of in vitro antiproteolytic activity against porcine pancreatic elastase as reactant/reagent. |
| | Boc-N-alpha-methyl-O-benzyl-L-tyrosine Preparation Products And Raw materials |
|