1-Iodo-2,3-dimethylbenzene manufacturers
- 1-Iodo-2,3-dimethylbenzene
-
- $1.00 / 1ASSAYS
-
2020-01-09
- CAS:31599-60-7
- Min. Order: 1ASSAYS
- Purity: 85.0-99.8%
- Supply Ability: 20tons
|
| | 1-Iodo-2,3-dimethylbenzene Basic information |
| | 1-Iodo-2,3-dimethylbenzene Chemical Properties |
| Melting point | -2.9°C (estimate) | | Boiling point | 110-111 °C12 mm Hg(lit.) | | density | 1.64 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.607(lit.) | | Fp | >230 °F | | storage temp. | 2-8°C(protect from light) | | form | clear liquid | | color | Light yellow to Brown | | Specific Gravity | 1.640 | | Sensitive | Light Sensitive | | BRN | 1929733 | | InChI | InChI=1S/C8H9I/c1-6-4-3-5-8(9)7(6)2/h3-5H,1-2H3 | | InChIKey | DANMWBNOPFBJSZ-UHFFFAOYSA-N | | SMILES | C1(I)=CC=CC(C)=C1C | | CAS DataBase Reference | 31599-60-7(CAS DataBase Reference) | | NIST Chemistry Reference | Benzene, 1-iodo-2,3-dimethyl-(31599-60-7) |
| Hazard Codes | Xi,C | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-37/39 | | WGK Germany | 3 | | Hazard Note | Irritant/Light Sensitive | | HazardClass | IRRITANT | | HS Code | 29036990 |
| | 1-Iodo-2,3-dimethylbenzene Usage And Synthesis |
| Chemical Properties | clear red-brown to brown liquid |
| | 1-Iodo-2,3-dimethylbenzene Preparation Products And Raw materials |
|