- Boc-Gly-OMe
-
- $0.00/ kg
-
2025-12-31
- CAS:31954-27-5
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T+
- Boc-Gly-OMe
-
- $30.00 / 500mg
-
2025-07-20
- CAS:31954-27-5
- Min. Order:
- Purity:
- Supply Ability: 10g
|
| | BOC-GLYCINE METHYL ESTER Basic information |
| Product Name: | BOC-GLYCINE METHYL ESTER | | Synonyms: | N-[(1,1-Dimethylethoxy)carbonyl]glycine Methyl Ester;N-(tert-Butoxycarbonyl)glycine Methyl ester, 97%+;BOC-GLYCINE METHYL ESTER;N-(TERT-BUTOXYCARBONYL)GLYCINE METHYL ESTER;Methyl [(tert-butoxycarbonyl)amino]acetate, N-(tert-Butoxycarbonyl)glycine methyl ester;Glycine,N-[(1,1-dimethylethoxy)carbonyl]-, methyl ester;Glycine methyl ester, N-BOC protected 97%;N-(tert-Butoxycarbonyl)glycine methyl ester 97% | | CAS: | 31954-27-5 | | MF: | C8H15NO4 | | MW: | 189.21 | | EINECS: | | | Product Categories: | Amino Acid Derivatives;Glycine;Peptide Synthesis;Miscellaneous | | Mol File: | 31954-27-5.mol |  |
| | BOC-GLYCINE METHYL ESTER Chemical Properties |
| Boiling point | 190 °C(lit.) | | density | 1.28 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.437(lit.) | | Fp | 109 °C | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Chloroform, Ethyl Acetate | | form | Oil | | pka | 11.06±0.46(Predicted) | | color | Colourless | | InChI | InChI=1S/C8H15NO4/c1-8(2,3)13-7(11)9-5-6(10)12-4/h5H2,1-4H3,(H,9,11) | | InChIKey | PHUZOEOLWIHIKH-UHFFFAOYSA-N | | SMILES | C(OC)(=O)CNC(OC(C)(C)C)=O |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29241990 |
| | BOC-GLYCINE METHYL ESTER Usage And Synthesis |
| Chemical Properties | Colorless to yellow liquid | | Uses | Boc-glycine methyl ester is a amino acid glycine (G615990) derivative, used widely in various synthetic preparations of pharmaceutical goods and antioxidants. N-[(1,1-Dime thylethoxy)carbonyl]glycine Methyl Ester can be used in the preparation of Pregabalin (P704800), a GABA analogue used as an anticonvulsant. | | Uses | It is used as a pharmaceutical, chemical, paint and dye intermediate. | | reaction suitability | reaction type: solution phase peptide synthesis |
| | BOC-GLYCINE METHYL ESTER Preparation Products And Raw materials |
|