|
|
| | 6-BROMOHEXANEAMIDE Basic information |
| Product Name: | 6-BROMOHEXANEAMIDE | | Synonyms: | 6-BROMOCAPROAMIDE;6-BROMOHEXANEAMIDE;6-Bromohexanamide;Hexanamide, 6-bromo-;6-Nitro-1,10-phenanthroline | | CAS: | 57817-55-7 | | MF: | C6H12BrNO | | MW: | 194.07 | | EINECS: | | | Product Categories: | | | Mol File: | 57817-55-7.mol |  |
| | 6-BROMOHEXANEAMIDE Chemical Properties |
| Melting point | 104-106°C | | Boiling point | 325.8±25.0 °C(Predicted) | | density | 1.370±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 16.57±0.40(Predicted) | | InChI | InChI=1S/C6H12BrNO/c7-5-3-1-2-4-6(8)9/h1-5H2,(H2,8,9) | | InChIKey | LGCGXHIRLZORQA-UHFFFAOYSA-N | | SMILES | C(N)(=O)CCCCCBr | | CAS DataBase Reference | 57817-55-7(CAS DataBase Reference) |
| Hazard Codes | Xi,C | | HazardClass | IRRITANT | | HS Code | 2924190090 |
| | 6-BROMOHEXANEAMIDE Usage And Synthesis |
| Chemical Properties | 6-bromohexanamide is a solid, it's XLogP3 is 0.9.
| | Uses |
6-Bromohexanamide is used in organic synthesis, pharmaceutical intermediates, and specialty chemicals.
|
| | 6-BROMOHEXANEAMIDE Preparation Products And Raw materials |
|