|
|
| | 3-METHYLGLUTARIC ACID Basic information |
| Product Name: | 3-METHYLGLUTARIC ACID | | Synonyms: | 3-Methylglutaric acid≥ 98% (Assay);3-Methylpropane-1,3-dicarboxylic acid;beta-Methylglutaric acid;Pentanedioic acid, 3-methyl-;B-METHYLGLUTARIC ACID;3-METHYLPENTANEDIOIC ACID;3-METHYLGLUTARIC ACID;3-Methylglutaricacid,99% | | CAS: | 626-51-7 | | MF: | C6H10O4 | | MW: | 146.14 | | EINECS: | 210-951-5 | | Product Categories: | Carbonyl Compounds;Carboxylic Acids;C6 | | Mol File: | 626-51-7.mol |  |
| | 3-METHYLGLUTARIC ACID Chemical Properties |
| Melting point | 81-86 °C(lit.) | | Boiling point | 311.39°C (rough estimate) | | density | 1.4528 (rough estimate) | | refractive index | 1.4336 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly, Sonicated), DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 4.24(at 25℃) | | color | White to Off-White | | Water Solubility | Soluble in water, and ethanol. | | BRN | 1759502 | | InChI | InChI=1S/C6H10O4/c1-4(2-5(7)8)3-6(9)10/h4H,2-3H2,1H3,(H,7,8)(H,9,10) | | InChIKey | XJMMNTGIMDZPMU-UHFFFAOYSA-N | | SMILES | C(O)(=O)CC(C)CC(O)=O | | CAS DataBase Reference | 626-51-7(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 29171900 | | Storage Class | 11 - Combustible Solids |
| | 3-METHYLGLUTARIC ACID Usage And Synthesis |
| Chemical Properties | WHITE FINE CRYSTALLINE POWDER | | Uses | 3-Methylglutaric Acid is used in preparation method of high-adhesion super weather-resistant powder coating. | | Definition | ChEBI: An alpha,omega-dicarboxylic acid that is glutaric acid substituted at position 3 by a methyl group. | | IC 50 | Human Endogenous Metabolite | | Purification Methods | Crystallise the acid from distilled water, then dry it under vacuum over conc H2SO4. [Beilstein 2 IV 1992.] |
| | 3-METHYLGLUTARIC ACID Preparation Products And Raw materials |
|