|
|
| | DIETHYLPHENYLPHOSPHINE Basic information |
| | DIETHYLPHENYLPHOSPHINE Chemical Properties |
| Melting point | 45 °C | | Boiling point | 120-121 °C/29 mmHg (lit.) | | density | 0.954 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.546(lit.) | | Fp | 185 °F | | form | Liquid | | Specific Gravity | 0.954 | | color | Colorless to Light yellow | | Water Solubility | Not miscible or difficult to mix in water. | | Sensitive | Air & Moisture Sensitive | | BRN | 742484 | | InChI | InChI=1S/C10H15P/c1-3-11(4-2)10-8-6-5-7-9-10/h5-9H,3-4H2,1-2H3 | | InChIKey | LVTCZSBUROAWTE-UHFFFAOYSA-N | | SMILES | P(CC)(CC)C1=CC=CC=C1 | | CAS DataBase Reference | 1605-53-4(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 17-26-36 | | RIDADR | UN3278 | | WGK Germany | 3 | | F | 10 | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29319090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | DIETHYLPHENYLPHOSPHINE Usage And Synthesis |
| Chemical Properties | Colorless liquid | | Uses | Diethylphenylphosphine is used as a catalyst for selective cross-dimerization, carboxyl migration reactions, selective hydrogenation, asymmetric induction by chiral diphosphines in ring contraction. | | reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction reaction type: Heck Reaction reaction type: Hiyama Coupling reaction type: Negishi Coupling reaction type: Sonogashira Coupling reaction type: Stille Coupling reaction type: Suzuki-Miyaura Coupling reagent type: ligand |
| | DIETHYLPHENYLPHOSPHINE Preparation Products And Raw materials |
|