|
|
| | Sodium 3-chloro-2-hydroxypropanesulphonate hemihydrate Basic information |
| | Sodium 3-chloro-2-hydroxypropanesulphonate hemihydrate Chemical Properties |
| Melting point | 256 °C (dec.)(lit.) | | Water Solubility | Soluble in water. | | BRN | 4164376 | | InChI | InChI=1S/C3H7ClO4S.Na.H2O/c4-1-3(5)2-9(6,7)8;;/h3,5H,1-2H2,(H,6,7,8);;1H2/q;+1;/p-1 | | InChIKey | ZPFGAXXLEFTBEU-UHFFFAOYSA-M | | SMILES | S([O-])(=O)(=O)CC(O)CCl.O.[Na+] |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | TSCA | Yes | | HS Code | 29055900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Sodium 3-chloro-2-hydroxypropanesulphonate hemihydrate Usage And Synthesis |
| Uses | Sodium 3-chloro-2-hydroxypropanesulfonate hemihydrate is used to prepare negatively charged probe particles to investigate effect of nanoporosity of cellulosic fibers on their streaming potential and their interactions with cationic polyelectrolytes, to prepare surface-derivatized microcrystalline cellulose (MCC) particles having either a strong positive or a strong negative zeta potential. | | General Description | 3-Chloro-2-hydroxy-1-propanesulfonic acid sodium salt hydrate is a novel anionic agent. |
| | Sodium 3-chloro-2-hydroxypropanesulphonate hemihydrate Preparation Products And Raw materials |
|