- Diethyl propylmalonate
-
- $0.00 / 1KG
-
2025-06-27
- CAS:2163-48-6
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 500000kg
- Diethyl propylmalonate
-
- $0.00 / 1kg
-
2025-06-20
- CAS:2163-48-6
- Min. Order: 1kg
- Purity: 0.99
- Supply Ability: 100tons
|
| | Diethyl propylmalonate Basic information |
| | Diethyl propylmalonate Chemical Properties |
| Boiling point | 221-222 °C (lit.) | | density | 0.987 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.418(lit.) | | Fp | 197 °F | | storage temp. | Sealed in dry,Room Temperature | | solubility | Soluble in Dichloromethane, Ethanol and Ethyl Acetate. | | form | Oil | | pka | 13.32±0.46(Predicted) | | color | Clear Colourless | | BRN | 510157 | | InChI | InChI=1S/C10H18O4/c1-4-7-8(9(11)13-5-2)10(12)14-6-3/h8H,4-7H2,1-3H3 | | InChIKey | GRRSDGHTSMJICM-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)C(CCC)C(OCC)=O | | CAS DataBase Reference | 2163-48-6(CAS DataBase Reference) | | NIST Chemistry Reference | Diethyl propylmalonate(2163-48-6) |
| | Diethyl propylmalonate Usage And Synthesis |
| Chemical Properties | Colourless Oil | | Uses | A diester derivative in relation to aquatic toxicity to Tetrahymena | | Uses | Diethyl n-propylmalonate was used in the synthesis of propylacrylic acid (PAA). | | Uses | Diethyl propylmalonate was used in the synthesis of propylacrylic acid (PAA). |
| | Diethyl propylmalonate Preparation Products And Raw materials |
|